|
|
| | Di-isononyl-cyclohexane-1,2-dicarboxylate Basic information |
| Product Name: | Di-isononyl-cyclohexane-1,2-dicarboxylate | | Synonyms: | 1,2-CYCLOHEXYLDICARBOXYLICACID,DIISONONYLESTER;Diisononyl 1,2-cyclohexanedicarboxylate;Diisononyl hexahydrophthalate;Di-isononyl-cyclohexane-1,2-dicarboxylate;1,2-Cyclohexandicarbonsurediisononylester;Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate;1,2-Cyclohexanedicarboxylicacid, diisononyl ester (9CI);1,2-Cyclohexanedicarboxylicacid, 1,2-diisononyl ester | | CAS: | 166412-78-8 | | MF: | C26H46O4-2 | | MW: | 422.64104 | | EINECS: | 605-439-7 | | Product Categories: | | | Mol File: | 166412-78-8.mol |  |
| | Di-isononyl-cyclohexane-1,2-dicarboxylate Chemical Properties |
| density | 0.93 g/cm3 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Dichloromethane (Slightly) | | form | Oil | | color | Colourless | | Henry's Law Constant | 1.4×10-1 mol/(m3Pa) at 25℃, HSDB (2015) | | Major Application | pharmaceutical | | InChI | 1S/C26H48O4/c1-21(2)15-9-5-7-13-19-29-25(27)23-17-11-12-18-24(23)26(28)30-20-14-8-6-10-16-22(3)4/h21-24H,5-20H2,1-4H3 | | InChIKey | HORIEOQXBKUKGQ-UHFFFAOYSA-N | | SMILES | O(CCCCCCC(C)C)C(=O)C1C(CCCC1)C(=O)OCCCCCCC(C)C |
| | Di-isononyl-cyclohexane-1,2-dicarboxylate Usage And Synthesis |
| Chemical Properties | DINCH is a colorless, odorless liquid with a specific gravity
slightly less than 1. | | Uses | Hexamoll is one of the new plasticizers being used, which shows a structure similar to the most commonly used o-phthalates. It is favoured to substitute DEHP by DINCH as plasticizer for flexible poly(vinyl chloride). | | Uses | It is used as a
plasticizer. | | Production Methods | DINCH is manufactured by the hydrogenation of DINP in the
presence of a catalyst and under pressure. |
| | Di-isononyl-cyclohexane-1,2-dicarboxylate Preparation Products And Raw materials |
|