|
|
| | cyclohex-1,4-ylene diisocyanate Basic information |
| Product Name: | cyclohex-1,4-ylene diisocyanate | | Synonyms: | cyclohex-1,4-ylene diisocyanate;1,4-diisocyanatocyclohexane;cyclohexane diisocyanate;CYCLOHEXANE,1,4-DIISOCYANATO-;1,4-cyclohexylene diisocyanate;(1,4-Cyclohexanediyl)bisisocyanate;(1,4-Cyclohexanediyl)diisocyanate;Cyclohexane-1,4-diylbisisocyanate | | CAS: | 2556-36-7 | | MF: | C8H10N2O2 | | MW: | 166.18 | | EINECS: | 219-869-4 | | Product Categories: | | | Mol File: | 2556-36-7.mol |  |
| | cyclohex-1,4-ylene diisocyanate Chemical Properties |
| Melting point | 55℃ | | Boiling point | 136℃ (15 Torr) | | density | 1.21±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C8H10N2O2/c11-5-9-7-1-2-8(4-3-7)10-6-12/h7-8H,1-4H2 | | InChIKey | CDMDQYCEEKCBGR-UHFFFAOYSA-N | | SMILES | C1(N=C=O)CCC(N=C=O)CC1 | | EPA Substance Registry System | 1,4-Cyclohexane diisocyanate (2556-36-7) |
| RIDADR | 2922 | | HazardClass | 8 | | PackingGroup | II |
| | cyclohex-1,4-ylene diisocyanate Usage And Synthesis |
| Uses | 1,4-Bis(isocyanato)cyclohexane is a reagent used in the synthesis of flame retardants based upon polyurethane.Environmental toxin on US EPA Toxic Release Inventory list (TRI) list. | | Reactivity Profile | Isocyanates and thioisocyanates, such as cyclohex-1,4-ylene diisocyanate, are incompatible with many classes of compounds, reacting exothermically to release toxic gases. Reactions with amines, aldehydes, alcohols, alkali metals, ketones, mercaptans, strong oxidizers, hydrides, phenols, and peroxides can cause vigorous releases of heat. Acids and bases initiate polymerization reactions in these materials. Some isocyanates react with water to form amines and liberate carbon dioxide. Base-catalysed reactions of isocyanates with alcohols should be carried out in inert solvents. Such reactions in the absence of solvents often occur with explosive violence, [Wischmeyer(1969)]. |
| | cyclohex-1,4-ylene diisocyanate Preparation Products And Raw materials |
|