| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:3-[2-(TriMethylsilyl)ethynyl]benzeneboronic acid pinacol ester, 97% CAS:915402-03-8 Package:1g Remarks:H58731
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:3-[(Trimethylsilyl)ethynyl]phenylboronic acid pinacol ester CAS:915402-03-8 Purity:98% Remarks:MR01030234
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:3-[(Trimethylsilyl)ethynyl]phenylboronic acid pinacol ester CAS:915402-03-8 Purity:97% Package:1G Remarks:719064-1G
|
| Company Name: |
Guangzhou Jhd Chemical Reagent Co., Ltd.
|
| Tel: |
020-84383047 |
| Email: |
sales@jhd.com.cn |
| Products Intro: |
Product Name:3-[2-(Trimethylsilyl)ethynyl]benzeneboronic acid pinacol ester, 97% CAS:915402-03-8 Package:1G;5G
|
|
| | 3-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenylethynyl-trimethylsilane Basic information |
| Product Name: | 3-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenylethynyl-trimethylsilane | | Synonyms: | trimethyl(2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethynyl)silane;3-[(Trimethylsilyl)ethynyl]phenylboronic acid pinacol ester;4,4,5,5-Tetramethyl-2-(3-trimethylsilanylethynyl-phenyl)-[1,3,2]dioxaborolane;3-[2-(TriMethylsilyl)ethynyl]benzeneboronic acid pinacol ester, 97%;3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)trimethylsilylethynylbenzene;Trimethyl((3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethynyl)silane;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[3-[2-(trimethylsilyl)ethynyl]phenyl]- | | CAS: | 915402-03-8 | | MF: | C17H25BO2Si | | MW: | 300.28 | | EINECS: | | | Product Categories: | | | Mol File: | 915402-03-8.mol | ![3-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenylethynyl-trimethylsilane Structure](CAS/GIF/915402-03-8.gif) |
| | 3-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenylethynyl-trimethylsilane Chemical Properties |
| Melting point | 86-90℃ | | Boiling point | 367.1±34.0 °C(Predicted) | | density | 0.98±0.1 g/cm3(Predicted) | | form | solid | | InChI | 1S/C17H25BO2Si/c1-16(2)17(3,4)20-18(19-16)15-10-8-9-14(13-15)11-12-21(5,6)7/h8-10,13H,1-7H3 | | InChIKey | LDKJXCOLGXLWKP-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2cccc(c2)C#C[Si](C)(C)C | | CAS DataBase Reference | 915402-03-8 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 3-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenylethynyl-trimethylsilane Usage And Synthesis |
| Uses | It is used as an active pharmaceutical intermediate. |
| | 3-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenylethynyl-trimethylsilane Preparation Products And Raw materials |
|