|
|
| | Boc-(+/-)-trans-2-aminocyclohexanol Basic information |
| Product Name: | Boc-(+/-)-trans-2-aminocyclohexanol | | Synonyms: | tert-Butyl (trans-2-hydroxycyclohexyl)carbaMate;tert-butyl (1R,2R)-2-hydroxycyclohexylcarbamate;1R,2R-Boc-2-aMinocyclohexanol;tert-butyl (2-hydroxycyclohexyl)carbaMate;Trans-tert-butyl 2-hydroxycyclohexyl)carbaMate;tert-Butyl (trans-2-hydroxycyclohexyl);rel-tert-Butyl N-[(1R,2R)-2-hydroxycyclohexyl]carbamate;tert-Butyl (1R,2R)-2-hydroxycyclohexyl | | CAS: | 121282-70-0 | | MF: | C11H21NO3 | | MW: | 215.29 | | EINECS: | | | Product Categories: | | | Mol File: | 121282-70-0.mol |  |
| | Boc-(+/-)-trans-2-aminocyclohexanol Chemical Properties |
| Boiling point | 337.7±31.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.11±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C11H21NO3/c1-11(2,3)15-10(14)12-8-6-4-5-7-9(8)13/h8-9,13H,4-7H2,1-3H3,(H,12,14)/t8-,9-/s3 | | InChIKey | XVROWZPERFUOCE-JQEWEITDNA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCCC[C@H]1O |&1:8,13,r| |
| | Boc-(+/-)-trans-2-aminocyclohexanol Usage And Synthesis |
| Uses | tert-Butyl (2-Hydroxycyclohexyl)carbamate is a reagent used in the preparation of N-aryl acetamides from the corresponding nitro compounds. | | Synthesis | General procedure for the synthesis of trans-N-Boc-cyclohexylamino alcohols from the compounds (CAS: 764659-69-0): the product of part A (8.0 g, 26.2 mmol) was dissolved in a solvent mixture of cyclohexene (100 mL) and ethanol (150 mL), and palladium/carbon catalyst (2.0 g) was added. The reaction mixture was heated to reflux for 6 h. Upon completion of the reaction, the catalyst was removed by filtration through a Celite pad. The filtrate was concentrated to afford tert-butyl (1S,2S)-2-hydroxy-cyclohexyl-carbamate (5.7 g, 100% yield) as a white solid. Mass spectral analysis showed M/Z 216.2 ([M + H]+). | | References | [1] Patent: WO2004/83174, 2004, A2. Location in patent: Page 172
[2] Patent: WO2005/87731, 2005, A1. Location in patent: Page/Page column 321
[3] Bioorganic and Medicinal Chemistry Letters, 2007, vol. 17, # 16, p. 4419 - 4427
[4] Bioorganic and Medicinal Chemistry, 2009, vol. 17, # 1, p. 119 - 132 |
| | Boc-(+/-)-trans-2-aminocyclohexanol Preparation Products And Raw materials |
|