| Company Name: |
VladaChem GmbH |
| Tel: |
+49-7246-3082843 +86-18411632868 |
| Email: |
info@vladachem.de |
|
| | N-Methyl-4-hydrazino-7-nitrobenzofurazan Basic information |
| Product Name: | N-Methyl-4-hydrazino-7-nitrobenzofurazan | | Synonyms: | NBD methylhydrazine
MNBDH;NBD METHYLHYDRAZINE;NBD Methylhydrazine [4-(1-Methylhydrazino)-7-nitrobenzofurazan];2,1,3-benzoxadiazole, 4-(1-methylhydrazino)-
7-nitro-;4-(1-methylhydrazino)-
7-nitro-benzooxadiazole;4-(n-methylhydrazino)-7-nitro-
1,2,3-benzooxadiazole;1-methyl-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)hydrazine;2,1,3-Benzoxadiazole, 4-(1-methylhydrazinyl)-7-nitro- | | CAS: | 214147-22-5 | | MF: | C7H7N5O3 | | MW: | 209.16 | | EINECS: | | | Product Categories: | UV-VISSpectroscopy;Derivatization Reagents;Derivatization Reagents HPLC;UV/Vis Reagents;UV/Visible (UV/VIS) Spectroscopy;Benzoxadiazole | | Mol File: | 214147-22-5.mol |  |
| | N-Methyl-4-hydrazino-7-nitrobenzofurazan Chemical Properties |
| Melting point | ~160 °C | | Boiling point | 425.7±55.0 °C(Predicted) | | density | 1.611±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in acetonitrile, methanol | | form | powder | | pka | 2.07±0.30, most basic, temperature:
25 °C | | color | Dark brown | | λmax | 487 nm | | BRN | 8316412 | | Major Application | Monitoring/detecting/
measuring/quantifying aldehydes and/or ketones
(carbonyl compounds) in air/smoke | | Biological Applications | Nitrite indicator; detecting aldehydes and/or ketones (carbonyl compounds),nitroaromatic compounds,creatinine in body fluids,telmisartan,hydrogen peroxide,peroxides,as a peroxidase substrate | | InChI | 1S/C7H7N5O3/c1-11(8)4-2-3-5(12(13)14)7-6(4)9-15-10-7/h2-3H,8H2,1H3 | | InChIKey | GVUXVETWVIWDEV-UHFFFAOYSA-N | | SMILES | CN(N)c1ccc([N+]([O-])=O)c2nonc12 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-Methyl-4-hydrazino-7-nitrobenzofurazan Usage And Synthesis |
| Description | NBD Methylhydrazine is a fluorescent reagent used for labeling carbonyl compounds such as aldehyde/ketone to form a Schiff base that can be reduced to a stable amine derivative by sodium borohydride (NaBH4) or sodium cyanoborohydride (NaCNH3) to form stable conjugates. | | Uses | Superior reagent for monitoring aldehydes and ketones in air. Fluorogenic peroxidase substrate. |
| | N-Methyl-4-hydrazino-7-nitrobenzofurazan Preparation Products And Raw materials |
|