| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Nitro-phenyl-N-benzylcarbamate Basic information |
| Product Name: | 4-Nitro-phenyl-N-benzylcarbamate | | Synonyms: | 4-Nitrophenyl N-Benzylcarbamate;4-Nitrophenyl benzylcarbamate;4-Nitrophenyl N-Benzylcarbamate >;Carbamic acid, N-(phenylmethyl)-, 4-nitrophenyl ester;N-Benzylcarbamic Acid 4-Nitrophenyl Ester;4-NITRO-PHENYL-N-BENZYLCARBAMATE;4-Nitrophenyl N-(phenylmethyl)carbamate | | CAS: | 124068-97-9 | | MF: | C14H12N2O4 | | MW: | 272.26 | | EINECS: | | | Product Categories: | | | Mol File: | 124068-97-9.mol |  |
| | 4-Nitro-phenyl-N-benzylcarbamate Chemical Properties |
| Melting point | 130.0 to 134.0 °C | | Boiling point | 436.1±45.0 °C(Predicted) | | density | 1.306±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 10.54±0.46(Predicted) | | form | powder to crystal | | color | White to Light yellow to Green | | BRN | 4261736 | | InChI | 1S/C14H12N2O4/c17-14(15-10-11-4-2-1-3-5-11)20-13-8-6-12(7-9-13)16(18)19/h1-9H,10H2,(H,15,17) | | InChIKey | OCAOEODBVXZHNZ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(OC(=O)NCc2ccccc2)cc1 | | CAS DataBase Reference | 124068-97-9 |
| WGK Germany | 3 | | HS Code | 2924.29.7790 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Nitro-phenyl-N-benzylcarbamate Usage And Synthesis |
| Uses | Reactant for preparation of:
- Radiofluorinated quinoxalinedione derivatives as potential ligands of the AMPA receptor
- Mono-substituted urea side chains in solid phase peptide synthesis
- 4-substituted-1,2,4-triazolidine-3,5-diones
- Aryl carbamates as probes for the inhibition mechanism of cholesterol esterase
|
| | 4-Nitro-phenyl-N-benzylcarbamate Preparation Products And Raw materials |
|