Triethylsulfonium bis(trifluoromethylsulfonyl)imide manufacturers
- Sulfonium
-
- $15.00
-
2021-07-02
- CAS:321746-49-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | Triethylsulfonium bis(trifluoromethylsulfonyl)imide Basic information |
| | Triethylsulfonium bis(trifluoromethylsulfonyl)imide Chemical Properties |
| Melting point | -35.5°C | | density | 1.47 | | refractive index | 1.4260 to 1.4300 | | Water Solubility | Insoluble in water | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | 1S/C6H15S.C2F6NO4S2/c1-4-7(5-2)6-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-6H2,1-3H3;/q+1;-1 | | InChIKey | BLODSRKENWXTLO-UHFFFAOYSA-N | | SMILES | CC[S+](CC)CC.FC(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F | | CAS DataBase Reference | 321746-49-0 | | ECW | 4.5 V |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29350090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Chronic 3
Eye Dam. 1 |
| | Triethylsulfonium bis(trifluoromethylsulfonyl)imide Usage And Synthesis |
| Conductivity | 5.12 mS/cm | | Uses | Triethylsulfonium bis(trifluoromethylsulfonyl)imide is a room-temperatureionic liquid(RTIL ) that can be used:
- As an electrolyte in electrochemical double-layer supercapacitors.
- As a model ionic liquid used in the studies of structure effect of ions on electrochemical windows (EWs).
- As a component of the gel polymer electrolyte, which is used in the construction of symmetrical electrical-double layercapacitors.
- As an electrolyte in the in-plane supercapacitor devices.
| | General Description | Symmetric and aliphatic trialkylsulfonium cations form room temperature molten salts with bis(trifluoromethylsulfonyl)imide. |
| | Triethylsulfonium bis(trifluoromethylsulfonyl)imide Preparation Products And Raw materials |
|