| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | (1R*,2'R*)-1-(2'-Hydroxy-2'-phenylethyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinoline Basic information |
| Product Name: | (1R*,2'R*)-1-(2'-Hydroxy-2'-phenylethyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinoline | | Synonyms: | (1R*,2′R*)-6,7-Dimethoxy-1,2,3,4-tetrahydro-alpha-phenylisoquinoline-1-ethanol;(1R*,2'R*)-1-(2'-Hydroxy-2'-phenylethyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinoline | | CAS: | 548443-20-5 | | MF: | C19H23NO3 | | MW: | 313.39 | | EINECS: | | | Product Categories: | | | Mol File: | 548443-20-5.mol |  |
| | (1R*,2'R*)-1-(2'-Hydroxy-2'-phenylethyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinoline Chemical Properties |
| Boiling point | 491.074±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.132±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 14.079±0.20(predicted) | | form | solid | | InChI | 1S/C19H23NO3/c1-22-18-10-14-8-9-20-16(15(14)11-19(18)23-2)12-17(21)13-6-4-3-5-7-13/h3-7,10-11,16-17,20-21H,8-9,12H2,1-2H3/t16-,17-/m1/s1 | | InChIKey | YCFTZQSGANFCHN-IAGOWNOFSA-N | | SMILES | O[C@@H](C1=CC=CC=C1)C[C@@H](NCC2)C(C=C3OC)=C2C=C3OC |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (1R*,2'R*)-1-(2'-Hydroxy-2'-phenylethyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinoline Usage And Synthesis |
| | (1R*,2'R*)-1-(2'-Hydroxy-2'-phenylethyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinoline Preparation Products And Raw materials |
|