|
|
| | 4-CHLORO-5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE Basic information |
| | 4-CHLORO-5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE Chemical Properties |
| storage temp. | Store at 0-8 °C | | form | solid | | Appearance | white solid | | InChI | InChI=1S/C8H7ClN2O/c1-12-6-4-11-8-5(7(6)9)2-3-10-8/h2-4H,1H3,(H,10,11) | | InChIKey | VAHOYWJOMYELTR-UHFFFAOYSA-N | | SMILES | C12NC=CC1=C(Cl)C(OC)=CN=2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-CHLORO-5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE Usage And Synthesis |
| | 4-CHLORO-5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE Preparation Products And Raw materials |
|