| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Trihydroxycoprostanic Acid CAS:547-98-8 Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:trihydroxycholestanoic acid CAS:547-98-8 Purity:3alpha,7alpha,12alpha-, powder Package:1MG Remarks:700070P-1MG
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:(3a,5b,7a,12a)-3,7,12-trihydroxy-Cholestan-26-oic acid CAS:547-98-8 Purity:TLC>=98% Package:1mg Remarks:B23080
|
| Company Name: |
Shanghai Hongye Biotechnology Co. Ltd
|
| Tel: |
400-9205774 |
| Email: |
sales@glpbio.cn |
| Products Intro: |
Product Name:Trihydroxycholestanoic Acid CAS:547-98-8 Purity:>98% Package:1mg;10mg;50mg;100mg;
|
(3a,5b,7a,12a)-3,7,12-trihydroxy-Cholestan-26-oic acid manufacturers
|
| | (3a,5b,7a,12a)-3,7,12-trihydroxy-Cholestan-26-oic acid Basic information |
| Product Name: | (3a,5b,7a,12a)-3,7,12-trihydroxy-Cholestan-26-oic acid | | Synonyms: | (3a,5b,7a,12a)-3,7,12-trihydroxy-Cholestan-26-oic acid;3α,7α,12α-Trihydroxy-5β-cholestan-26-oic acid;3α,7α,12α-Trihydroxy-5β-cholestan-27-oic acid;3α,7α,12α-Trihydroxy-5β-cholestanoic acid;3α,7α,12α-Trihydroxycoprostanoic acid;THCA;Trihydroxycholestanoic acid;3alpha,7alpha,12alpha-trihydroxy-5beta-cholestan-26-oic acid | | CAS: | 547-98-8 | | MF: | C27H46O5 | | MW: | 450.65 | | EINECS: | | | Product Categories: | | | Mol File: | 547-98-8.mol |  |
| | (3a,5b,7a,12a)-3,7,12-trihydroxy-Cholestan-26-oic acid Chemical Properties |
| storage temp. | -20°C | | solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChIKey | CNWPIIOQKZNXBB-VCVMUKOKSA-N | | SMILES | O[C@H]1[C@@H]2[C@@H]([C@@]4([C@H](C1)C[C@@H](CC4)O)C)C[C@@H]([C@]3([C@H]2CC[C@@H]3[C@@H](CCCC(C)C(=O)O)C)C)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (3a,5b,7a,12a)-3,7,12-trihydroxy-Cholestan-26-oic acid Usage And Synthesis |
| Uses | 3α,7α,12α-Trihydroxycoprostanic Acid is a precursor of Cholic Acid (C432600), it undergoes side chain oxidation during the synthesis of bile acids. It was found that Zellweger’s syndrome patients have abnormal mitochondrial structure, the organelle that is responsible for the side chain oxidation, and as a consequence, excess amounts of 3α,7α,12α-Trihydroxycoprostanic Acid. | | Definition | ChEBI: A steroid acid that is 5beta-cholestan-26-oic acid which is substituted by hydroxy groups as the 3alpha, 7alpha, and 12alpha positions. | | General Description | Trihydroxycholestanoic acid (THCA) is an oxidative metabolite of cholesterol and a precursor to bile acids. Very long-chain acyl-CoA synthetase (VLCS) associated with endoplasmic reticulum and peroxisomes activates THCA, the C27 bile acid intermediate. | | Biochem/physiol Actions | Trihydroxycholestanoic acid (THCA) and dihydroxycholestanoic (DHCA) accumulation is observed in Zellweger syndrome and cholestatic liver disease. The synthesis of (25R)-isomer of DHCA and THCA is favored by mitochondrial 27-hydroxylase. |
| | (3a,5b,7a,12a)-3,7,12-trihydroxy-Cholestan-26-oic acid Preparation Products And Raw materials |
|