|
|
| | 2-(3,4-Dimethoxy-phenyl)-4-methyl-thiazole-5-carboxylic acid Basic information |
| Product Name: | 2-(3,4-Dimethoxy-phenyl)-4-methyl-thiazole-5-carboxylic acid | | Synonyms: | 2-(3,4-DIMETHOXYPHENYL)-4-METHYL-1,3-THIAZOLE-5-CARBOXYLIC ACID;2-(3,4-dimethoxyphenyl)-4-methyl-5-thiazolecarboxylic acid;3G-308S;Oprea1_501396;5-Thiazolecarboxylic acid, 2-(3,4-dimethoxyphenyl)-4-methyl-;2-(3,4-Dimethoxy-phenyl)-4-methyl-thiazole-5-carboxylic acid | | CAS: | 400080-46-8 | | MF: | C13H13NO4S | | MW: | 279.31 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-(3,4-Dimethoxy-phenyl)-4-methyl-thiazole-5-carboxylic acid Chemical Properties |
| Boiling point | 476.9±55.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | pka | 1.21±0.37(Predicted) | | form | solid | | InChI | 1S/C13H13NO4S/c1-7-11(13(15)16)19-12(14-7)8-4-5-9(17-2)10(6-8)18-3/h4-6H,1-3H3,(H,15,16) | | InChIKey | XLOKWLWQQDZOIT-UHFFFAOYSA-N | | SMILES | CC1=C(C(O)=O)SC(C2=CC=C(OC)C(OC)=C2)=N1 | | CAS DataBase Reference | 400080-46-8 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(3,4-Dimethoxy-phenyl)-4-methyl-thiazole-5-carboxylic acid Usage And Synthesis |
| | 2-(3,4-Dimethoxy-phenyl)-4-methyl-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|