|
|
| | Methyl 2,5,6-trichloropyrimidine-4-carboxylate Basic information | | Uses |
| Product Name: | Methyl 2,5,6-trichloropyrimidine-4-carboxylate | | Synonyms: | NSC64342;Methyl 2,5,6-trichloro-4-pyrimidinecarboxylate;Methyl 2,5,6-trichloropyriMidine-4-carboxylate;6-Methoxycarbonyl-2,4,5-trichloropyrimidine;6-trichloropyriMidine-4-carboxylate;4-Pyrimidinecarboxylic acid, 2,5,6-trichloro-, methyl ester;2,4,5-Trichloro-pyrimidine-6-carboxylic acid methyl ester;Methyl2,5,6-trichloropyrimidine-4-carbox | | CAS: | 89284-85-5 | | MF: | C6H3Cl3N2O2 | | MW: | 241.46 | | EINECS: | | | Product Categories: | Herbicide | | Mol File: | 89284-85-5.mol |  |
| | Methyl 2,5,6-trichloropyrimidine-4-carboxylate Chemical Properties |
| Melting point | 46-49° | | Boiling point | 342.7±37.0 °C(Predicted) | | density | 1.613±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -7.25±0.39(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H3Cl3N2O2/c1-13-5(12)3-2(7)4(8)11-6(9)10-3/h1H3 | | InChIKey | TVFOOGACHSHHSX-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=C(Cl)C(C(OC)=O)=N1 |
| HazardClass | IRRITANT | | HS Code | 2933599590 |
| | Methyl 2,5,6-trichloropyrimidine-4-carboxylate Usage And Synthesis |
| Uses | Methyl 2,5,6-trichloropyrimidine-4-carboxylate can be used as reactant/reagent in preparation of 7H-pyrrolo[2,3-d]pyrimidine and 1H-pyrrolo[3,2-c]pyridine derivatives as herbicidal compounds. |
| | Methyl 2,5,6-trichloropyrimidine-4-carboxylate Preparation Products And Raw materials |
|