| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ammonium hexafluorostannate Basic information |
| | Ammonium hexafluorostannate Chemical Properties |
| form | Liquid | | InChI | 1S/6FH.2H3N.Sn/h6*1H;2*1H3;/q;;;;;;;;+4/p-4 | | InChIKey | UWWCEQYTGCAXHS-UHFFFAOYSA-J | | SMILES | [NH4+].[NH4+].F[Sn--](F)(F)(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3146 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ammonium hexafluorostannate Usage And Synthesis |
| Uses | Ammonium Hexafluorostannate is a reactant in the preparation of SnO2 nanotube arrays. | | reaction suitability | reagent type: catalyst core: tin |
| | Ammonium hexafluorostannate Preparation Products And Raw materials |
|