| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 5-[[pyridin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypenta noic acid Basic information |
| Product Name: | 5-[[pyridin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypenta noic acid | | Synonyms: | 5-[[pyridin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypenta noic acid;ridogrel;5-[[(E)-(3-Pyridinyl)[3-(trifluoromethyl)phenyl]methylene]aminooxy]valeric acid;5-[[[(E)-α-(Pyridine-3-yl)-3-(trifluoromethyl)benzylidene]amino]oxy]valeric acid;R-68070;Pentanoic acid, 5-[[(E)-[3-pyridinyl[3-(trifluoromethyl)phenyl]methylene]amino]oxy]-;R 70416;R70416 | | CAS: | 110140-89-1 | | MF: | C18H17F3N2O3 | | MW: | 366.33 | | EINECS: | | | Product Categories: | | | Mol File: | 110140-89-1.mol | ![5-[[pyridin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypenta noic acid Structure](CAS/GIF/110140-89-1.gif) |
| | 5-[[pyridin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypenta noic acid Chemical Properties |
| Melting point | 70.3° | | Boiling point | 495.2±55.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 2mg/mL, clear | | pka | 4.70±0.10(Predicted) | | form | Solid | | color | White to light yellow | | InChI | 1S/C18H17F3N2O3/c19-18(20,21)15-7-3-5-13(11-15)17(14-6-4-9-22-12-14)23-26-10-2-1-8-16(24)25/h3-7,9,11-12H,1-2,8,10H2,(H,24,25)/b23-17- | | InChIKey | GLLPUTYLZIKEGF-QJOMJCCJSA-N | | SMILES | O=C(O)CCCCO/N=C(C1=CC=CN=C1)\C2=CC=CC(C(F)(F)F)=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-[[pyridin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypenta noic acid Usage And Synthesis |
| Uses | Inhibitor (thromboxane synthetase). | | Uses | Ridogrel is a dual thromboxane synthase inhibitor and receptor antagonist that may have therapeutic benefits in ulcerative colitis. | | Definition | ChEBI: Ridogrel is a member of (trifluoromethyl)benzenes. | | Biological Activity | Ridogrel is an orally active, potent and specific combined thromboxane synthase inhibitor and thromboxane A2 receptor ( thromboxane/prostaglandin endoperoxide receptor) antagonist. Ridogrel is a potent antiplatelet agent. | | IC 50 | EP |
| | 5-[[pyridin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypenta noic acid Preparation Products And Raw materials |
|