|
|
| | 2-Butanone, 4,4,4-trifluoro-3-hydroxy-3-methyl-, (3S)- Basic information |
| Product Name: | 2-Butanone, 4,4,4-trifluoro-3-hydroxy-3-methyl-, (3S)- | | Synonyms: | 2-Butanone, 4,4,4-trifluoro-3-hydroxy-3-methyl-, (3S)-;(3S)-4,4,4-Trifluoro-3-hydroxy-3-methyl-2-butanone;(S)-4,4,4-Trifluoro-3-hydroxy-3-methylbutan-2-one | | CAS: | 2877757-07-6 | | MF: | C5H7F3O2 | | MW: | 156.1 | | EINECS: | | | Product Categories: | | | Mol File: | 2877757-07-6.mol |  |
| | 2-Butanone, 4,4,4-trifluoro-3-hydroxy-3-methyl-, (3S)- Chemical Properties |
| Boiling point | 152.6±35.0 °C(Predicted) | | density | 1.278±0.06 g/cm3(Predicted) | | pka | 10.50±0.29(Predicted) | | InChI | InChI=1S/C5H7F3O2/c1-3(9)4(2,10)5(6,7)8/h10H,1-2H3/t4-/m0/s1 | | InChIKey | KMEKVKQRLNAOKB-BYPYZUCNSA-N | | SMILES | CC(=O)[C@@](O)(C)C(F)(F)F |
| | 2-Butanone, 4,4,4-trifluoro-3-hydroxy-3-methyl-, (3S)- Usage And Synthesis |
| | 2-Butanone, 4,4,4-trifluoro-3-hydroxy-3-methyl-, (3S)- Preparation Products And Raw materials |
|