| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
cyclopenin manufacturers
- Cyclopenin
-
- $753.00
-
2026-04-22
- CAS:20007-87-8
- Purity:
- Supply Ability: 10g
|
| | cyclopenin Basic information |
| Product Name: | cyclopenin | | Synonyms: | cyclopenin;Spiro[3H-1,4-benzodiazepine-3,2'-oxirane]-2,5(1H,4H)-dione, 4-methyl-3'-phenyl-, (2'R,3'S)-rel-(-)-;NSC 114538;NSC 604989;NSC114538;NSC-114538;NSC604989;NSC-604989 | | CAS: | 20007-87-8 | | MF: | C17H14N2O3 | | MW: | 294.31 | | EINECS: | | | Product Categories: | | | Mol File: | 20007-87-8.mol |  |
| | cyclopenin Chemical Properties |
| Melting point | 183-184 °C | | Boiling point | 572.5±50.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: soluble | | form | A solid | | pka | 12.92±0.40(Predicted) | | biological source | plant | | Water Solubility | water: slightly soluble | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C17H14N2O3/c1-19-15(20)12-9-5-6-10-13(12)18-16(21)17(19)14(22-17)11-7-3-2-4-8-11/h2-10,14H,1H3,(H,18,21) | | InChIKey | APLKWZASYUZSBL-UHFFFAOYSA-N | | SMILES | N1(C3(OC3c4ccccc4)C(=O)Nc2c(cccc2)C1=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | cyclopenin Usage And Synthesis |
| Description | Cyclopenin is an inhibitor of acetylcholinesterase (AChE; IC50 = 2.04 μM for human recombinant AChE) that is produced by Penicillium. It exhibits greater than 2,000-fold selectivity over recombinant equine butyrylcholinesterase with an IC50 value greater than 4,080 μM. Cyclopenin also has antibacterial activity against E. coli and M. pyogenes. | | Uses | (-)-Cyclopenin ((-)-Cyclopenine) is the enantiomer of Cyclopenin. Cyclopenin is a selective acetylcholinesterase (AChE) inhibitor with the IC50 of 2.04 μM[1]. | | Definition | ChEBI: (-)-cyclopenine is an epoxide. | | References | [1] F Kuno, et al. Arisugacins A and B, novel and selective acetylcholinesterase inhibitors from Penicillium sp. FO-4259. II. Structure elucidation. J Antibiot (Tokyo). 1996 Aug;49(8):748-51. DOI:10.7164/antibiotics.49.748 |
| | cyclopenin Preparation Products And Raw materials |
|