|
|
| | thionitrobenzoic acid Basic information |
| Product Name: | thionitrobenzoic acid | | Synonyms: | thionitrobenzoic acid;MDPV Methylenedioxypyrovalerone;5-thio-2-nitrobenzoic acid;Benzoic acid, 5-mercapto-2-nitro-;Benzoic acid,5-mercapto-2-nitro- CAS NO.15139-21-6;5-Mercapto-2-nitrobenzoic acid(TNB);TNB, Yellow chromogenic standard for DTNB thiol quantification;2-Nitro-5-sulfanylbenzoic acid | | CAS: | 15139-21-6 | | MF: | C7H5NO4S | | MW: | 199.19 | | EINECS: | | | Product Categories: | pharmaceutical intermediates | | Mol File: | 15139-21-6.mol |  |
| | thionitrobenzoic acid Chemical Properties |
| Boiling point | 419.2±40.0 °C(Predicted) | | density | 1.575±0.06 g/cm3(Predicted) | | pka | 1.96±0.25(Predicted) | | InChI | InChI=1S/C7H5NO4S/c9-7(10)5-3-4(13)1-2-6(5)8(11)12/h1-3,13H,(H,9,10) | | InChIKey | GANZODCWZFAEGN-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(S)=CC=C1[N+]([O-])=O |
| | thionitrobenzoic acid Usage And Synthesis |
| | thionitrobenzoic acid Preparation Products And Raw materials |
|