| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,6-Dinitrotoluene-alpha,alpha,alpha-d3 Basic information |
| Product Name: | 2,6-Dinitrotoluene-alpha,alpha,alpha-d3 | | Synonyms: | 2,6-DINITROTOLUENE (METHYL-D3);2,6-Dinitrotoluene-3,5,6-D3;2,6-Dinitrotoluene-α,α,α-d3;2,6-DINITROTOLUENE (METHYL-D3, 98%) 1 MG/ML IN ACETONITRILE;2,6-Dinitrotoluene-α,α,α-d?;2,6-Dinitrotoluene-d3 in acetonitrile;2,6-Dinitrotoluene-α,α,α-d3;2,6-Dinitrotoluene-α,α,α-d3 | | CAS: | 93951-90-7 | | MF: | C7H6N2O4 | | MW: | 182.14 | | EINECS: | | | Product Categories: | | | Mol File: | 93951-90-7.mol |  |
| | 2,6-Dinitrotoluene-alpha,alpha,alpha-d3 Chemical Properties |
| Melting point | 56-61 °C(lit.) | | form | solid | | InChI | 1S/C7H6N2O4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3/i1D3 | | InChIKey | XTRDKALNCIHHNI-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])c1c(cccc1[N+]([O-])=O)[N+]([O-])=O |
| Hazard Codes | T | | Risk Statements | 45-23/24/25-48/22-52/53-62-68 | | Safety Statements | 53-45-61 | | RIDADR | UN 3454 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 3
Carc. 1B
Muta. 2
Repr. 2
STOT RE 2 |
| | 2,6-Dinitrotoluene-alpha,alpha,alpha-d3 Usage And Synthesis |
| Uses | 2,6-Dinitrotoluene-alpha,alpha,alpha-d3 (CAS# 93951-90-7) is a useful isotopically labeled research compound. |
| | 2,6-Dinitrotoluene-alpha,alpha,alpha-d3 Preparation Products And Raw materials |
|