|
|
| | Ethyl chlorofluoroacetate Basic information |
| | Ethyl chlorofluoroacetate Chemical Properties |
| Boiling point | 133 °C (lit.) | | density | 1.212 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.396(lit.) | | Fp | 125 °F | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.225 | | BRN | 1748679 | | InChI | InChI=1S/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3 | | InChIKey | WUHVJSONZHSDFC-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(Cl)F | | CAS DataBase Reference | 401-56-9(CAS DataBase Reference) | | EPA Substance Registry System | Acetic acid, chlorofluoro-, ethyl ester (401-56-9) |
| Hazard Codes | C,F,Xi | | Risk Statements | 10-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3
Skin Corr. 1B |
| | Ethyl chlorofluoroacetate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Ethyl chlorofluoroacetate may be used in the synthesis of:
- chlorofluoroacetamide
- ethyl α-fluoro silyl enol ether
- chlorofluoroacetyl chloride
|
| | Ethyl chlorofluoroacetate Preparation Products And Raw materials |
|