| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | (N)1-acetylisoniazid Basic information |
| | (N)1-acetylisoniazid Chemical Properties |
| Melting point | 158-159°C | | Boiling point | 311.69°C (rough estimate) | | density | 1.2896 (rough estimate) | | refractive index | 1.7400 (estimate) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C8H9N3O2/c1-6(12)10-11-8(13)7-2-4-9-5-3-7/h2-5H,1H3,(H,10,12)(H,11,13) | | InChIKey | CVBGNAKQQUWBQV-UHFFFAOYSA-N | | SMILES | C1=NC=CC(C(NNC(C)=O)=O)=C1 |
| | (N)1-acetylisoniazid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Isoniazid (I821450) | | Definition | ChEBI: A carbohydrazide resulting from the formal condensation of the carboxy group of isonicotinic acid with hydrazine and subsequent acetylation of the monosubstituted nitrogen atom. |
| | (N)1-acetylisoniazid Preparation Products And Raw materials |
|