- Barium tartrate
-
- $1.00
-
2026-02-06
- CAS:5908-81-6
- Min. Order: 1kg
- Purity: 0.99+
- Supply Ability: 80000
- BARIUM TARTRATE
-
- $15.00
-
2021-08-11
- CAS:5908-81-6
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | BARIUM TARTRATE Basic information |
| Product Name: | BARIUM TARTRATE | | Synonyms: | L(+)-TARTARIC ACID BARIUM SALT;(+)-BARIUM TARTRATE;BARIUM TARTRATE;(+)-barium tartrate dibasic;tartaric acid barium salt;2,3-Dihydroxybutanedioic acid barium salt;barium L-tartrate;(2R,3R)-Barium Tartrate | | CAS: | 5908-81-6 | | MF: | C4H4BaO6 | | MW: | 287.41 | | EINECS: | 227-615-9 | | Product Categories: | | | Mol File: | 5908-81-6.mol |  |
| | BARIUM TARTRATE Chemical Properties |
| density | 2,98 g/cm3 | | solubility | soluble in H2O; insoluble in ethanol | | form | white crystals | | color | white crystals, crystalline | | Water Solubility | Very slightly soluble in water | | BRN | 6120238 | | Exposure limits | ACGIH: TWA 0.5 mg/m3
NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 | | InChI | InChI=1S/C4H6O6.Ba/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 | | InChIKey | HQYOWPDUMCBSLQ-UHFFFAOYSA-L | | SMILES | C1(O)C(=O)O[Ba]OC(=O)C1O | | LogP | -3.4 at 20℃ and pH7 | | CAS DataBase Reference | 5908-81-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 28 | | RIDADR | UN 1564 6.1/PG 3 | | WGK Germany | 1 | | HazardClass | 6.1 | | PackingGroup | III |
| | BARIUM TARTRATE Usage And Synthesis |
| Chemical Properties | White crystals. Soluble in water; insoluble in alcohol. | | Uses | Pyrotechnics. |
| | BARIUM TARTRATE Preparation Products And Raw materials |
|