|
|
| | SNICOTINEN1OXIDE Basic information |
| Product Name: | SNICOTINEN1OXIDE | | Synonyms: | SNICOTINEN1OXIDE;(2S)-1-Methyl-2-(3-pyridyl)pyrrolidine 1-oxide;[2S,(-)]-1-Methyl-2α-(3-pyridinyl)pyrrolidine 1-oxide;3-[(2S)-1-methyl-1-oxidopyrrolidin-1-ium-2-yl]pyridine;Nicotine EP Impurity E (N-Oxide);Nicotine EP Impurity E (Mixture ofDiastereomers);Pyridine, 3-[(2S)-1-methyl-1-oxido-2-pyrrolidinyl]-;Nicotine-N'-oxide
DISCONTINUED, offer N427510 | | CAS: | 491-26-9 | | MF: | C10H14N2O | | MW: | 178.23 | | EINECS: | | | Product Categories: | | | Mol File: | 491-26-9.mol |  |
| | SNICOTINEN1OXIDE Chemical Properties |
| storage temp. | 2-8°C | | pka | 4.63±0.40(Predicted) | | Major Application | pharmaceutical | | InChI | 1S/C10H14N2O/c1-12(13)7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-,12/m0/s1 | | InChIKey | RWFBQHICRCUQJJ-NUHJPDEHSA-N | | SMILES | [N]1(=O)([C@@H](CCC1)c2cnccc2)C | | CAS DataBase Reference | 491-26-9 | | EPA Substance Registry System | Pyridine, 3-[(2S)-1-methyl-1-oxido-2-pyrrolidinyl]- (491-26-9) |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | SNICOTINEN1OXIDE Usage And Synthesis |
| Uses | Nicotine-N''-oxide is is used as a reactant in the preparation and cyanation of nicotine derivatives and analogs and use in stimulating α7 nAChR and/or α4β2 receptors | | Definition | ChEBI: (S)-nicotine N(1')-oxide is a nicotine N(1')-oxide resulting from the oxidation of the pyrrolidine nitrogen of (S)-nicotine; major species at pH 7.3. It is functionally related to a (S)-nicotine. | | Hazard | A poison. |
| | SNICOTINEN1OXIDE Preparation Products And Raw materials |
|