|
|
| | 1-Naphthylamine-7-sulfonic acid Basic information | | Synthesis |
| | 1-Naphthylamine-7-sulfonic acid Chemical Properties |
| Melting point | ≥300 °C(lit.) | | Boiling point | 220°C (rough estimate) | | density | 1.3588 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Aqueous Base (Slightly), DMSO (Slightly, Sonicated) | | pka | pK1: 3.66 (25°C) | | form | Powder | | Appearance | Gray to brown Solid | | Merck | 14,2351 | | BRN | 2115629 | | InChI | InChI=1S/C10H9NO3S/c11-10-3-1-2-7-4-5-8(6-9(7)10)15(12,13)14/h1-6H,11H2,(H,12,13,14) | | InChIKey | QEZZCWMQXHXAFG-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2N)=CC=C1S(O)(=O)=O | | CAS DataBase Reference | 119-28-8(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Naphthylamine-7-sulfonic acid(119-28-8) | | EPA Substance Registry System | 2-Naphthalenesulfonic acid, 8-amino- (119-28-8) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2585 8/PG 3 | | WGK Germany | 2 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214500 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Irrit. 2 |
| | 1-Naphthylamine-7-sulfonic acid Usage And Synthesis |
| Synthesis | 1-Naphthylamine-7-sulfonic acid can be obtained by sulfonation, nitration, neutralization, reduction and acid precipitation of naphthalene. | | Chemical Properties | Brown crystalline. 1-Aminonaphthalene-7-sulfonic acid [119- 28-8]. (8-aminonaphthalene-2-sulfonic acid), 1,7-Cleve’s acid, C10H9NO3S, Mr 223.24, is 0.5 % soluble in water at 25℃ and 3 % soluble at 100 ℃. The sodium, potassium, calcium, and magnesium salts are readily soluble in water but the barium salt is only sparingly soluble. Sulfonation with oleum at 50℃ gives 1- aminonaphthalene-4,7-disulfonic acid. Alkali fusion gives 8-amino-2-naphthol, and Bucherer-type hydrolysis gives 1-hydroxynaphthalene-7-sulfonic acid. | | Uses | Intermediate of dyestuff | | Uses | 8-Amino-2-naphthalenesulfonic acid can be used as a reactant to synthesize:
- Fe3O4/sulfonated polyaniline composite material via chemical oxidative polymerization with aniline in the presence of magnetite (Fe3O4) nanoparticles.
- Prismatic crystals of strychnine-8-ammonio-2-naphthalenesulfonate-water by heating with strychnine in water/ethanol solvent mixture.
- 5-amino-9-dialkylamino benzo[a]phenoxazine dyes (Nile blue analogs) by condensation with N-alkyl or N-sulfo-propyl 4-arylazo-substituted 3-hydroxyaniline.
| | Application | 1-Naphthylamine-7-sulfonic acid can be used as a dye intermediate to prepare dyes such as direct light fast blue B2RL, direct light fast red brown RTL, and sulfur blue CV. |
| | 1-Naphthylamine-7-sulfonic acid Preparation Products And Raw materials |
|