|
|
| | 2,4-Dimethylcinnamic acid Basic information | | Uses |
| Product Name: | 2,4-Dimethylcinnamic acid | | Synonyms: | 2,4-DIMETHYLCINNAMIC ACID;(2E)-3-(2,4-DIMETHYLPHENYL)ACRYLIC ACID;3-(2,4-DIMETHYLPHENYL)ACRYLIC ACID;RARECHEM BK HC T312;(E)-3-(2,4-dimethylphenyl)prop-2-enoic acid;3-(2,4-Dimethylphenyl)acrylic acid, 3-(2,4-Dimethylphenyl)prop-2-enoic acid;2-Propenoic acid, 3-(2,4-dimethylphenyl)-;3-(2,4-Dimethylphenyl)acrylicaci | | CAS: | 1685-80-9 | | MF: | C11H12O2 | | MW: | 176.21 | | EINECS: | | | Product Categories: | Aromatic Cinnamic Acids, Esters and Derivatives | | Mol File: | 1685-80-9.mol |  |
| | 2,4-Dimethylcinnamic acid Chemical Properties |
| Melting point | 179-180°C | | Boiling point | 310.0±11.0 °C(Predicted) | | density | 1.118±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 4.60±0.13(Predicted) | | InChI | 1S/C14H12O3/c1-17-13-8-6-10(7-9-14(15)16)11-4-2-3-5-12(11)13/h2-9H,1H3,(H,15,16)/b9-7+ | | InChIKey | BDWSMCXLZKKQFV-VQHVLOKHSA-N | | SMILES | O=C(O)/C=C/C1=CC=C(OC)C2=C1C=CC=C2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 2,4-Dimethylcinnamic acid Usage And Synthesis |
| Uses | This product is an organic synthesis intermediate. |
| | 2,4-Dimethylcinnamic acid Preparation Products And Raw materials |
|