| Company Name: |
ChemOrigin Pharm Gold |
| Tel: |
15026428026 19002516454 |
| Email: |
ChemOrigin@126.com |
|
| | 2,6-Piperidinedione, 3-(3-bromo-2-chlorophenyl)- Basic information |
| | 2,6-Piperidinedione, 3-(3-bromo-2-chlorophenyl)- Chemical Properties |
| Boiling point | 445.1±45.0 °C(predicted) | | density | 1.611±0.06 g/cm3(Temp: 20 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at room temperature | | pka | 10.97±0.40(predicted) | | form | Powder | | color | White to off-white | | InChI | InChI=1S/C11H9BrClNO2/c12-8-3-1-2-6(10(8)13)7-4-5-9(15)14-11(7)16/h1-3,7H,4-5H2,(H,14,15,16) | | InChIKey | ALZZHOGCXUFQPV-UHFFFAOYSA-N | | SMILES | O=C1NC(CCC1C1C=CC=C(C=1Cl)Br)=O |
| | 2,6-Piperidinedione, 3-(3-bromo-2-chlorophenyl)- Usage And Synthesis |
| Uses | CRBN ligand-13 is a CRBN-type E3 ubiquitin ligase ligand that can be used to prepare PROTAC. | | IC 50 | Cereblon | | References | [1] Mileti N, et al. Workflow for E3 Ligase Ligand Validation for PROTAC Development. ACS Chem Biol. 2025 Feb 21;20(2):507-521. DOI:10.1021/acschembio.4c00812 |
| | 2,6-Piperidinedione, 3-(3-bromo-2-chlorophenyl)- Preparation Products And Raw materials |
|