|
|
| | 2-{5-[(1H-1,2,4-Tr iazool-1-yl)methyl]indool-3-yl}ethaan-1-ol Basic information |
| Product Name: | 2-{5-[(1H-1,2,4-Tr iazool-1-yl)methyl]indool-3-yl}ethaan-1-ol | | Synonyms: | 2-[5-(1,2,4-Triazol-1-ylmethyl)-1H-indol-3-yl]ethanol;2-(6-((1H-1,2,4-triazol-1-yl)methyl)-1H-indol-3-yl)ethanol;5-(1H-1,2,4-triazol-1-ylmethyl)-1H-Indole-3-ethanol;Rizatriptan EP Impurity F;Rizatriptan Impurity 6（Rizatriptan EP Impurity F）;1H-Indole-3-ethanol,5-(1H-1,2,4-triazol-1-ylmethyl)-;2-[5-(1H-1,2,4-Triazol-1-ylmethyl)-1H-indol-3-yl]ethanol;RFizatriptan EP Impurity F | | CAS: | 160194-39-8 | | MF: | C13H14N4O | | MW: | 242.28 | | EINECS: | | | Product Categories: | | | Mol File: | 160194-39-8.mol | ![2-{5-[(1H-1,2,4-Tr iazool-1-yl)methyl]indool-3-yl}ethaan-1-ol Structure](CAS/20180808/GIF/160194-39-8.gif) |
| | 2-{5-[(1H-1,2,4-Tr iazool-1-yl)methyl]indool-3-yl}ethaan-1-ol Chemical Properties |
| Boiling point | 545.5±60.0 °C(Predicted) | | density | 1.35 | | storage temp. | 2-8°C | | pka | 14.95±0.10(Predicted) | | form | solid | | Major Application | pharmaceutical small molecule | | InChI | 1S/C13H14N4O/c18-4-3-11-6-15-13-2-1-10(5-12(11)13)7-17-9-14-8-16-17/h1-2,5-6,8-9,15,18H,3-4,7H2 | | InChIKey | WXWBRTKSGCYLQS-UHFFFAOYSA-N | | SMILES | [n]3(ncnc3)Cc1cc2c([nH]cc2CCO)cc1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-{5-[(1H-1,2,4-Tr iazool-1-yl)methyl]indool-3-yl}ethaan-1-ol Usage And Synthesis |
| Uses | 5-(1H-1,2,4-Triazol-1-ylmethyl)-1H-indole-3-ethanol is an intermediate in the synthesis of Rizatriptan Benzoate (R545000); a selective serotonin 5-HT1D receptor agonist and a potential anti-migraine drug. |
| | 2-{5-[(1H-1,2,4-Tr iazool-1-yl)methyl]indool-3-yl}ethaan-1-ol Preparation Products And Raw materials |
|