|
|
| | Rizatriptan N10-Oxide Basic information |
| | Rizatriptan N10-Oxide Chemical Properties |
| Melting point | 153-156°C (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Methanol (Slightly) | | form | Solid | | pka | 16+-.0.30(Predicted) | | color | Off-White to Pale Yellow | | Major Application | pharmaceutical small molecule | | InChI | 1S/C15H19N5O/c1-20(2,21)6-5-13-8-17-15-4-3-12(7-14(13)15)9-19-11-16-10-18-19/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3 | | InChIKey | DQTBNOJGXNZYDG-UHFFFAOYSA-N | | SMILES | [N](=O)(CCc1c2c([nH]c1)ccc(c2)C[n]3ncnc3)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Rizatriptan N10-Oxide Usage And Synthesis |
| Chemical Properties | Pale Yellow Gel | | Uses | Rizatriptan N10-Oxide (Rizatriptan EP Impurity H) is a metabolite of Rizatriptan (R545000). |
| | Rizatriptan N10-Oxide Preparation Products And Raw materials |
|