2-Amino-N-(4-chloro-phenyl)-benzamide manufacturers
|
| | 2-Amino-N-(4-chloro-phenyl)-benzamide Basic information |
| Product Name: | 2-Amino-N-(4-chloro-phenyl)-benzamide | | Synonyms: | Benzamide,2-amino-N-(4-chlorophenyl)-;CP-74006;4-Chloroanthranilanilide;CP74006|||CP 74006|||2-Amino-N-(4-chlorophenyl)benzamide;Prostaglandin G/H synthase 1 inhibitor;Prostaglandin G/H synthase 1 inhibitor, 10 mM in DMSO;2-Amino-N-(4-chlorophenyl)benzamide | | CAS: | 4943-86-6 | | MF: | C13H11ClN2O | | MW: | 246.69 | | EINECS: | | | Product Categories: | | | Mol File: | 4943-86-6.mol |  |
| | 2-Amino-N-(4-chloro-phenyl)-benzamide Chemical Properties |
| Melting point | 148-149 °C | | Boiling point | 337.2±27.0 °C(Predicted) | | density | 1.351±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid | | pka | 12.37±0.70(Predicted) | | color | White to light brown | | InChI | 1S/C13H11ClN2O/c14-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)15/h1-8H,15H2,(H,16,17) | | InChIKey | RHCJFZKQYODIDI-UHFFFAOYSA-N | | SMILES | ClC(C=C1)=CC=C1NC(C2=CC=CC=C2N)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-Amino-N-(4-chloro-phenyl)-benzamide Usage And Synthesis |
| Uses | CP-74006 (compound11h) is a selective Cyclooxygenase-1 inhibitor[1]. | | References | [1] Kakuta H, et al. Cyclooxygenase-1-selective inhibitors are attractive candidates for analgesics that do not cause gastric damage. design and in vitro/in vivo evaluation of a benzamide-type cyclooxygenase-1 selective inhibitor. J Med Chem. 2008;51(8):2400-2411. DOI:10.1021/jm701191z |
| | 2-Amino-N-(4-chloro-phenyl)-benzamide Preparation Products And Raw materials |
|