| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
2-Amino-4-(3,4-dimethoxy-phenyl)-thiophene-3-carboxylic acid ethyl ester manufacturers
- aPKC-I
-
- $2500.00
-
2026-05-11
- CAS:15854-12-3
- Purity:
- Supply Ability: 10g
|
| | 2-Amino-4-(3,4-dimethoxy-phenyl)-thiophene-3-carboxylic acid ethyl ester Basic information |
| | 2-Amino-4-(3,4-dimethoxy-phenyl)-thiophene-3-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 437.3±45.0 °C(Predicted) | | density | 1.234±0.06 g/cm3(Predicted) | | pka | -0.29±0.10(Predicted) | | form | solid | | InChI | 1S/C15H17NO4S/c1-4-20-15(17)13-10(8-21-14(13)16)9-5-6-11(18-2)12(7-9)19-3/h5-8H,4,16H2,1-3H3 | | InChIKey | OZWGHIQPWZHYPG-UHFFFAOYSA-N | | SMILES | [s]1c(c(c(c1)c2cc(c(cc2)OC)OC)C(=O)OCC)N |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 2-Amino-4-(3,4-dimethoxy-phenyl)-thiophene-3-carboxylic acid ethyl ester Usage And Synthesis |
| Uses | aPKC-IN-1 (compound 1) is an atypical protein kinase C (aPKCζ) inhibitor. aPKC-IN-1 can be used for the study of a host of diseases involving increased vascular permeability and inflammation[1]. | | References | [1] Paul M Titchenellm, et al. Synthesis and structure-activity relationships of 2-amino-3-carboxy-4-phenylthiophenes as novel atypical protein kinase C inhibitors. Bioorg Med Chem Lett. 2013 May 15;23(10):3034-8. DOI:10.1016/j.bmcl.2013.03.019 |
| | 2-Amino-4-(3,4-dimethoxy-phenyl)-thiophene-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|