| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 2-nitro-1-imidazoleacetate Basic information |
| | Methyl 2-nitro-1-imidazoleacetate Chemical Properties |
| Melting point | 95-97 °C (lit.) | | Boiling point | 372.4±44.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | 0.30±0.31(Predicted) | | color | Pale Yellow | | InChI | 1S/C6H7N3O4/c1-13-5(10)4-8-3-2-7-6(8)9(11)12/h2-3H,4H2,1H3 | | InChIKey | KXEHVMQCOHOQHB-UHFFFAOYSA-N | | SMILES | COC(=O)Cn1ccnc1[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Methyl 2-nitro-1-imidazoleacetate Usage And Synthesis |
| Uses | 2-Nitro-1H-imidazole-1-acetic Acid Methyl Ester is an intermediate in the synthesis Benznidazole (B197927), is a labelled analogue of Benznidazole (B197925). | | General Description | Methyl 2-nitro-1-imidazoleacetate is an imidazole derivative. |
| | Methyl 2-nitro-1-imidazoleacetate Preparation Products And Raw materials |
|