| Company Name: |
Shanghai Changyan Chem & Tech Co., Ltd. Gold
|
| Tel: |
021-20242659 18930833303 |
| Email: |
sales@changyanchem.cn |
| Products Intro: |
Product Name:4-Piperazin-1-yl-quinoline
CAS:118306-89-1
Purity:96 Package:25g
|
| Company Name: |
Sichuan BoYou Biotechnology Co., Ltd.
|
| Tel: |
028-65791793 18140026355 |
| Email: |
568470422@qq.com |
| Products Intro: |
Product Name:4-(piperazin-1-yl)quinoline
CAS:118306-89-1
Purity:95 Package:10g;100g;1kg;5kg
|
| Company Name: |
Jinan ponder chemical co. LTD
|
| Tel: |
0531-0000 |
| Email: |
thinklifescience@163.com |
| Products Intro: |
Product Name:118306-89-1
CAS:118306-89-1
Purity:99% HPLC Package:1KG;500G;100G；50G;1G
|
| Company Name: |
Ningbo jinuo chemical co., LTD
|
| Tel: |
0574-87314919 057487319282 |
| Email: |
info@nbinno.com |
| Products Intro: |
Product Name:4-(1-Piperazinyl)Quinoline
CAS:118306-89-1
Purity:99%
|
| Company Name: |
Shanghai Haohong Scientific Co., Ltd.
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:4-(Piperazin-1-yl)quinoline
CAS:118306-89-1
Purity:98+% Package:100mg
|
|
| | 4-PIPERAZIN-1-YL-QUINOLINE Basic information |
| | 4-PIPERAZIN-1-YL-QUINOLINE Chemical Properties |
| Boiling point | 403.7±25.0 °C(Predicted) | | density | 1.152±0.06 g/cm3(Predicted) | | pka | 10.14±0.46(Predicted) | | InChI | InChI=1S/C13H15N3/c1-2-4-12-11(3-1)13(5-6-15-12)16-9-7-14-8-10-16/h1-6,14H,7-10H2 | | InChIKey | CGSWRHKBLLDUHO-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(N2CCNCC2)=CC=1 |
| | 4-PIPERAZIN-1-YL-QUINOLINE Usage And Synthesis |
| | 4-PIPERAZIN-1-YL-QUINOLINE Preparation Products And Raw materials |
|