| Company Name: |
Yichang Zhongyitai Trading Co., Ltd.
|
| Tel: |
0717-6449896 13886658719 |
| Email: |
root@zhongyitai.com |
| Products Intro: |
Product Name:Valeryl-L-Carnitine Chloride Purity:98% Package:25Mg;100Mg
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Valeryl-L-carnitine chloride CAS:162040-64-4 Purity:98% Package:1G;10G;100G Remarks:Valeryl-L-carnitine is a short-chain acylcarnitine and a derivative of L-carnitine.
|
| Company Name: |
Shanghai Hongye Biotechnology Co. Ltd
|
| Tel: |
400-9205774 400-920-5774 |
| Email: |
sales@glpbio.cn |
| Products Intro: |
Product Name:Valeryl-L-carnitine (chloride) CAS:162040-64-4 Purity:>98% Package:1mg;10mg;50mg;100mg;
|
VALERYL-L-CARNITINE CHLORIDE manufacturers
|
| | VALERYL-L-CARNITINE CHLORIDE Basic information |
| Product Name: | VALERYL-L-CARNITINE CHLORIDE | | Synonyms: | VALERYL-L-CARNITINE CHLORIDE;5,5,5-2H3]-Valeryl-L-Carnitine HCl salt;C5:0 L-carnitine (HCl salt);5,5,5-D3-Valeryl-L-Carnitine HCl salt | | CAS: | 162040-64-4 | | MF: | C12H22ClNO3 | | MW: | 263.76098 | | EINECS: | | | Product Categories: | | | Mol File: | 162040-64-4.mol |  |
| | VALERYL-L-CARNITINE CHLORIDE Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMF: 15 mg/ml; DMSO: 20 mg/ml; Ethanol: 25 mg/ml; PBS (pH 7.2): 10 mg/ml | | form | A solid | | InChIKey | REFPVMRTHIMPLJ-HNCPQSOCSA-N | | SMILES | C[N+](C)(C)C[C@H](OC(CCCC)=O)CC(O)=O.[Cl-] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | VALERYL-L-CARNITINE CHLORIDE Usage And Synthesis |
| Uses | Valeryl-L-carnitine Chloride is a derivative ofL-carnitine, which is a cofactor that facilitates the oxidation of fatty acid.Valeryl-L-carnitine Chloridecan be used to synthesizeantidepressants for treatinggeriatric depression andmay have potential application for developing nutrient conjugates that can be transported across the blood brain barrier. |
| | VALERYL-L-CARNITINE CHLORIDE Preparation Products And Raw materials |
|