| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Email: |
|
| Products Intro: |
Product Name:(1H-Indol-3-yl)-acetic acid
CAS:24420-86-8
Purity:96%Min Package:10g 100g 500g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Indole-3-acetic-2,2-d2 acid
CAS:24420-86-8
Purity:98 atom % D, 98% (CP) Package:100MG Remarks:492817-100MG
|
INDOLE-3-ACETIC-ALPHA,ALPHA-D2 ACID manufacturers
|
| | INDOLE-3-ACETIC-ALPHA,ALPHA-D2 ACID Basic information |
| Product Name: | INDOLE-3-ACETIC-ALPHA,ALPHA-D2 ACID | | Synonyms: | INDOLE-3-ACETIC-ALPHA,ALPHA-D2 ACID;INDOLE-3-ACETIC-ALPHA,ALPHA-D2 ACID, 97 ATOM % D;indole-3-acetic-2,2-d2acid;3-indoleacetic acid-α,α-d2;Deuterated indole-3-acetic acid;Heteroauxin-α,α-d2;IAA-α,α-d2;Indole-3-acetic-2,2-d2 acid 98 atom % D, 98% (CP) | | CAS: | 24420-86-8 | | MF: | C10H7D2NO2 | | MW: | 177.2 | | EINECS: | | | Product Categories: | Alphabetical Listings;I-LStable Isotopes;Metabolic Research;Other;Stable Isotopes | | Mol File: | 24420-86-8.mol |  |
| | INDOLE-3-ACETIC-ALPHA,ALPHA-D2 ACID Chemical Properties |
| Melting point | 165-169 °C(lit.) | | Boiling point | 415.030±20.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.355±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.486±0.30(predicted) | | color | Pale Orange to Light Red | | InChI | 1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/i5D2 | | InChIKey | SEOVTRFCIGRIMH-BFWBPSQCSA-N | | SMILES | [2H]C([2H])(C(O)=O)c1c[nH]c2ccccc12 | | CAS Number Unlabeled | 87-51-4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | INDOLE-3-ACETIC-ALPHA,ALPHA-D2 ACID Usage And Synthesis |
| Uses | 3-Indoleacetic acid-2,2-d2 is the deuterium labeled 3-Indoleacetic acid (HY-18569). 3-Indoleacetic acid (Indole-3-acetic acid) is the most common natural plant growth hormone of the auxin class. It can be added to cell culture medium to induce plant cell elongation and division[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | INDOLE-3-ACETIC-ALPHA,ALPHA-D2 ACID Preparation Products And Raw materials |
|