|
|
| | 2-(quinolin-3-yl)acetic acid Basic information |
| | 2-(quinolin-3-yl)acetic acid Chemical Properties |
| Boiling point | 383.8±17.0 °C(Predicted) | | density | 1.297±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 3.18±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C11H9NO2/c13-11(14)6-8-5-9-3-1-2-4-10(9)12-7-8/h1-5,7H,6H2,(H,13,14) | | InChIKey | GQOJGBVTUSRBPQ-UHFFFAOYSA-N | | SMILES | O=C(CC1=CC2=CC=CC=C2N=C1)O |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(quinolin-3-yl)acetic acid Usage And Synthesis |
| | 2-(quinolin-3-yl)acetic acid Preparation Products And Raw materials |
|