| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 6-O-Trityl-2,3,4-tri-O-acetyl-α-D-galactopyranoside Basic information |
| Product Name: | Methyl 6-O-Trityl-2,3,4-tri-O-acetyl-α-D-galactopyranoside | | Synonyms: | Methyl 2,3,4-tri-O-acetyl-6-O-trityl-a-D-galactopyranoside;Methyl 2,3,4-tri-O-acetyl-6-O-trityl-α-D-galactopyranoside;2,3,4-Triacetyl-6-trityl-α-methylgalactoside;Methyl 6-O-(Triphenylmethyl)-α-D-galactopyranoside Triacetate;Methyl 6-O-Trityl-2,3,4-tri-O-acetyl-α-D-galactopyranoside;2,3,4-Triacetyl-6-trityl-a-methylgalactoside;Methyl 6-O-(Triphenylmethyl)-a-D-galactopyranoside Triacetate;Methyl 6-O-Trityl-2,3,4-tri-O-acetyl-a-D-galactopyranoside | | CAS: | 38982-56-8 | | MF: | C32H34O9 | | MW: | 562.61 | | EINECS: | | | Product Categories: | 13C & 2H Sugars;Carbohydrates & Derivatives;Carbohydrates | | Mol File: | 38982-56-8.mol |  |
| | Methyl 6-O-Trityl-2,3,4-tri-O-acetyl-α-D-galactopyranoside Chemical Properties |
| Melting point | 177-182°C | | Boiling point | 612.213±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.256±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | Chloroform, Dichloromethane, Ethyl Acetate, Methanol | | form | Solid | | color | White | | Optical Rotation | [α]22/D +55°, c = 1% in chloroform | | InChIKey | CEIHIENXWVDRTC-NBCLCUQJSA-N | | SMILES | CC(O[C@H]1[C@@H](COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)O[C@H](OC)[C@H](OC(C)=O)[C@H]1OC(C)=O)=O | | CAS DataBase Reference | 38982-56-8 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | Methyl 6-O-Trityl-2,3,4-tri-O-acetyl-α-D-galactopyranoside Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Methyl 6-O-Trityl-2,3,4-tri-O-acetyl-α-D-galactopyranoside (cas# 38982-56-8) is a compound useful in organic synthesis. |
| | Methyl 6-O-Trityl-2,3,4-tri-O-acetyl-α-D-galactopyranoside Preparation Products And Raw materials |
|