|
|
| | 1,3-Benzodioxole-5,6-diamine dihydrochloride Basic information |
| Product Name: | 1,3-Benzodioxole-5,6-diamine dihydrochloride | | Synonyms: | 4,5-METHYLENEDIOXY-1,2-PHENYLENEDIAMINE DIHYDROCHLORIDE;5,6-DIAMINO-1,3-BENZODIOXOLE DIHYDROCHLORIDE;DMB, DIHYDROCHLORIDE;1,2-diamino-4,5-methylenedioxybenzene*dihydrochlo;5,6-Diaminobenzo[1,3]dioxole dihydrochloride;4,5-Methylenedioxy-o-phenylenediamine dihydrochloride;1,2-DIAMINO-4,5-METHYLENEDIOXYBENZENE*DI HYDROCHLORI;1,2-Diamino-4,5-methylenedioxybenzene2HCl | | CAS: | 81864-15-5 | | MF: | C7H10Cl2N2O2 | | MW: | 225.07 | | EINECS: | | | Product Categories: | Amines;Benzodiozoles, Benzodioxines & Benzodioxepines;Aldehyde Labeling Reagents;Aromatics;Benzodiozoles, Benzodioxines & Benzodioxepines | | Mol File: | 81864-15-5.mol |  |
| | 1,3-Benzodioxole-5,6-diamine dihydrochloride Chemical Properties |
| Melting point | 247-249 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | H2O: soluble50mg/mL | | form | powder | | color | Light Brown | | Water Solubility | H2O: 50mg/mL | | BRN | 5641607 | | Stability: | Light Sensitive | | InChI | 1S/C7H8N2O2.2ClH/c8-4-1-6-7(2-5(4)9)11-3-10-6;;/h1-2H,3,8-9H2;2*1H | | InChIKey | YXEJRYIEFFUUID-UHFFFAOYSA-N | | SMILES | Cl[H].Cl[H].Nc1cc2OCOc2cc1N | | CAS DataBase Reference | 81864-15-5 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10-23 | | Hazard Note | Irritant | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,3-Benzodioxole-5,6-diamine dihydrochloride Usage And Synthesis |
| Chemical Properties | Light Brown Solid | | Uses | A highly sensitive reagent for a-keto acids. A fluorometric labeling reagent | | Uses | A highly sensitive reagent for α-keto acids. A fluorometric labeling reagent. Dyes and metabolites. |
| | 1,3-Benzodioxole-5,6-diamine dihydrochloride Preparation Products And Raw materials |
|