2-(1-METHYL-5-NITRO-1H-IMIDAZOL-2-YL)-PROPAN-2-OL manufacturers
|
| | 2-(1-METHYL-5-NITRO-1H-IMIDAZOL-2-YL)-PROPAN-2-OL Basic information |
| | 2-(1-METHYL-5-NITRO-1H-IMIDAZOL-2-YL)-PROPAN-2-OL Chemical Properties |
| Melting point | 108-110°C | | Boiling point | 367.7±22.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 13.44±0.29(Predicted) | | color | Yellow to Orange | | Major Application | forensics and toxicology pharmaceutical (small molecule) | | InChI | 1S/C7H11N3O3/c1-7(2,11)6-8-4-5(9(6)3)10(12)13/h4,11H,1-3H3 | | InChIKey | DTHPMNDYKOSVFR-UHFFFAOYSA-N | | SMILES | Cn1c(cnc1C(C)(C)O)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(1-METHYL-5-NITRO-1H-IMIDAZOL-2-YL)-PROPAN-2-OL Usage And Synthesis |
| Chemical Properties | Orange Solid | | Uses | The alcohol metabolite of Ipronidazole (I747000). |
| | 2-(1-METHYL-5-NITRO-1H-IMIDAZOL-2-YL)-PROPAN-2-OL Preparation Products And Raw materials |
|