| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Boc-1,8-diaminooctane Basic information |
| Product Name: | 1-Boc-1,8-diaminooctane | | Synonyms: | N-t-Butyloxycarbonyl-1,8-diaminooctane;Boc-DAOct;tert-Butyl (8-aminooct-1-yl)carbamate;Octane-1,8-diamine, N-BOC protected 95%;tert-Butyl (8-aminooct-1-yl)carbamate, 1,8-Diaminooctane, N-BOC protected;N-tert-Butoxycarbonyl-1,8-octanediaMine;Carbamic acid,N-(8-aminooctyl)-, 1,1-dimethylethyl ester;TERT-BUTYL 8-AMINOOCTYLCARBAMATE | | CAS: | 88829-82-7 | | MF: | C13H28N2O2 | | MW: | 244.37 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 88829-82-7.mol |  |
| | 1-Boc-1,8-diaminooctane Chemical Properties |
| Melting point | 73-74 °C | | Boiling point | 356.3±25.0 °C(Predicted) | | density | 0.942±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform, Methanol | | form | Solid | | pka | 12.94±0.46(Predicted) | | color | Off-White | | InChI | InChI=1S/C13H28N2O2/c1-13(2,3)17-12(16)15-11-9-7-5-4-6-8-10-14/h4-11,14H2,1-3H3,(H,15,16) | | InChIKey | BEHVGNKIRNVBPF-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCCCCCCCN |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2921290090 |
| | 1-Boc-1,8-diaminooctane Usage And Synthesis |
| Description | tert-butyl (8-aminooctyl)carbamate can be used as a PROTAC linker in the synthesis of PROTACs. tert-butyl (8-aminooctyl)carbamate is an alkane chain with terminal amine and Boc-protected amino groups. Amine group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | Uses | tert-Butyl (8-aminooctyl)carbamate (1-Boc-1,8-diaminooctane) can be used as a PROTAC linker in the synthesis of PROTACs. tert-butyl (8-aminooctyl)carbamate is an alkane chain with terminal amine and Boc-protected amino groups. Amine group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine. |
| | 1-Boc-1,8-diaminooctane Preparation Products And Raw materials |
|