DIETHYL 2-ACETYLGLUTARATE manufacturers
- DIETHYL 2-ACETYLGLUTARATE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1501-06-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | DIETHYL 2-ACETYLGLUTARATE Basic information |
| Product Name: | DIETHYL 2-ACETYLGLUTARATE | | Synonyms: | Diethyl 2-acetylglutarate,97%;2-ACETYLGLUTARIC ACID DIETHYL ESTER;Diethyl 2-acetylpentanedioate;Diethyl alpha-acetoglutarate;Diethyl alpha-acetylglutarate;Pentanedioic acid, 2-acetyl-, diethyl ester;TIMTEC-BB SBB007698;AKOS MSC-0251 | | CAS: | 1501-06-0 | | MF: | C11H18O5 | | MW: | 230.26 | | EINECS: | 216-114-0 | | Product Categories: | C10 to C11;Carbonyl Compounds;Esters | | Mol File: | 1501-06-0.mol |  |
| | DIETHYL 2-ACETYLGLUTARATE Chemical Properties |
| Boiling point | 154 °C/11 mmHg (lit.) | | density | 1.071 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.439(lit.) | | Fp | >230 °F | | form | liquid | | pka | 11.32±0.59(Predicted) | | Specific Gravity | 1.071 | | BRN | 1371947 | | InChI | 1S/C11H18O5/c1-4-15-10(13)7-6-9(8(3)12)11(14)16-5-2/h9H,4-7H2,1-3H3 | | InChIKey | NNOGMCQLKMLNPL-UHFFFAOYSA-N | | SMILES | CCOC(=O)CCC(C(C)=O)C(=O)OCC | | CAS DataBase Reference | 1501-06-0(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | DIETHYL 2-ACETYLGLUTARATE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO LIGHT YELLOW LIQUID | | Uses | Diethyl α-Acetylglutarate is used in the preparation of furocoumarins as potential HIV-1 integrase inhibitors. |
| | DIETHYL 2-ACETYLGLUTARATE Preparation Products And Raw materials |
|