| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | D-Alanine-13C3 Basic information |
| | D-Alanine-13C3 Chemical Properties |
| Melting point | 291 °C (dec.) (lit.) | | form | solid | | Optical Rotation | [α]25/D -14.5°, c = 2 in 1 M HCl | | InChI | 1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m1/s1/i1+1,2+1,3+1 | | InChIKey | QNAYBMKLOCPYGJ-FMYLKJIZSA-N | | SMILES | [H][13C@]([13CH3])(N)[13C](O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-Alanine-13C3 Usage And Synthesis |
| | D-Alanine-13C3 Preparation Products And Raw materials |
|