| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Dimethylamino-2,2,6,6-tetramethylpiperidine Basic information |
| Product Name: | 4-Dimethylamino-2,2,6,6-tetramethylpiperidine | | Synonyms: | N,N,2,2,6,6-Hexamethyl-4-piperidinamine;4-Dimethylamino-2,2,6,6-tetramethylpiperidine 96%;N,N,2,2,6,6-hexamethylpiperidin-4-amine;4-Piperidinamine, N,N,2,2,6,6-hexamethyl-;4-Dimethylamino-2,2,6,6-tetramethylpiperidine | | CAS: | 32327-90-5 | | MF: | C11H24N2 | | MW: | 184.32 | | EINECS: | 623-629-8 | | Product Categories: | API intermediates;Building Blocks;Heterocyclic Building Blocks;Piperidines | | Mol File: | 32327-90-5.mol |  |
| | 4-Dimethylamino-2,2,6,6-tetramethylpiperidine Chemical Properties |
| Boiling point | 213.5±8.0 °C(Predicted) | | density | 0.88±0.1 g/cm3(Predicted) | | refractive index | n20/D 1.4641(lit.) | | Fp | 120 °F | | pka | 10.83±0.10(Predicted) | | InChI | 1S/C11H24N2/c1-10(2)7-9(13(5)6)8-11(3,4)12-10/h9,12H,7-8H2,1-6H3 | | InChIKey | LRAJIZNKBMCWJE-UHFFFAOYSA-N | | SMILES | CN(C)C1CC(C)(C)NC(C)(C)C1 |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 4-Dimethylamino-2,2,6,6-tetramethylpiperidine Usage And Synthesis |
| Uses | Reactant for:
Self-aggregation of supramolecules of nitroxides
Synthesis of unsymmetrical spin-labeled bolaamphiphiles |
| | 4-Dimethylamino-2,2,6,6-tetramethylpiperidine Preparation Products And Raw materials |
|