|
|
| | 4-ETHYL-1,3-DIOXOLAN-2-ONE Basic information |
| Product Name: | 4-ETHYL-1,3-DIOXOLAN-2-ONE | | Synonyms: | TIMTEC-BB SBB008625;1,2-BUTYLENE GLYCOL CARBONATE;4-ETHYL-1,3-DIOXOLAN-2-ONE;carbonicacid,cyclicethylethyleneester;1,2-butanediol,cycliccarbonate;1,2-butylenecarbonate;3-Dioxolan-2-one,4-ethyl-1;4-ethyl-3-dioxolan-2-one | | CAS: | 4437-85-8 | | MF: | C5H8O3 | | MW: | 116.12 | | EINECS: | 403-780-4 | | Product Categories: | | | Mol File: | 4437-85-8.mol |  |
| | 4-ETHYL-1,3-DIOXOLAN-2-ONE Chemical Properties |
| Melting point | -45 °C | | Boiling point | 251 °C | | density | 1.141 | | refractive index | 1.426-1.428 | | Fp | 135 °C | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C5H8O3/c1-2-4-3-7-5(6)8-4/h4H,2-3H2,1H3 | | InChIKey | ZZXUZKXVROWEIF-UHFFFAOYSA-N | | SMILES | O1CC(CC)OC1=O | | LogP | 0.099 (est) | | CAS DataBase Reference | 4437-85-8 | | EPA Substance Registry System | 1,3-Dioxolan-2-one, 4-ethyl- (4437-85-8) |
| Safety Statements | 24/25 | | RIDADR | 1993 | | RTECS | JI4582000 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29209010 |
| Provider | Language |
|
ACROS
| English |
| | 4-ETHYL-1,3-DIOXOLAN-2-ONE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1,2-Butylene Carbonate is used in planarizing process and composition. |
| | 4-ETHYL-1,3-DIOXOLAN-2-ONE Preparation Products And Raw materials |
|