|
|
| | 1-(4-Chlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde Basic information |
| | 1-(4-Chlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde Chemical Properties |
| Melting point | 151-153° | | Boiling point | 383.8±48.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | -1.42±0.70(Predicted) | | InChI | 1S/C9H6ClN3O/c10-7-1-3-9(4-2-7)13-5-8(6-14)11-12-13/h1-6H | | InChIKey | QMQRIACXYRMOBZ-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)-n2cc(C=O)nn2 |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 1-(4-Chlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde Usage And Synthesis |
| Uses | 1-(4-Chlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde is used as a reactant in the preparation of N-phenyl-1,2,3-triazole derivatives for antitubercular activity. |
| | 1-(4-Chlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde Preparation Products And Raw materials |
|