- N3-PEG1-N3
-
-
2025-06-07
- CAS:24345-74-2
- Min. Order: 250mg
- Purity: >98.00%
- Supply Ability: 250mg
|
| | Bis(2-azidoethyl)ether Basic information |
| | Bis(2-azidoethyl)ether Chemical Properties |
| Melting point | NA | | Boiling point | 75 °C(Press: 2.5 Torr) | | storage temp. | -20°C Freezer | | solubility | DMSO : 100 mg/mL (640.41 mM; Need ultrasonic) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C4H8N6O/c5-9-7-1-3-11-4-2-8-10-6/h1-4H2 | | InChIKey | NQEPBRYUGPSVPU-UHFFFAOYSA-N | | SMILES | C(N=[N+]=[N-])COCCN=[N+]=[N-] |
| | Bis(2-azidoethyl)ether Usage And Synthesis |
| Chemical Properties | Clear Colorless Oil | | Uses | Multifunctional alkylating agent | | IC 50 | PEGs |
| | Bis(2-azidoethyl)ether Preparation Products And Raw materials |
|