Norglipin manufacturers
- Norglipin
-
- $7.00 / 1KG
-
2020-01-14
- CAS:16444-19-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000kg
|
| | Norglipin Basic information |
| Product Name: | Norglipin | | Synonyms: | 1aH,5aH-Nortropan-3a-ol Benzilate;a-Hydroxy-a-phenylbenzeneacetic Acid (3-endo)-8-Azabicyclo[3.2.1]oct-3-yl Ester;N-Desmethyl Tropan-3a-yl-(2-hydroxy-2,2-diphenyl)acetate;Norglipin;Nortropinyl benzilate;(1R,3r,5S)-8-Azabicyclo[3.2.1]oct-3-yl hydroxydiphenylacetate;2-hydroxy-2,2-diphenylacetic acid 8-azabicyclo[3.2.1]octan-3-yl ester;Benzeneacetic acid, a-hydroxy-a-phenyl-, (3-endo)-8-azabicyclo[3.2.1]oct-3-ylester | | CAS: | 16444-19-2 | | MF: | C21H23NO3 | | MW: | 337.41 | | EINECS: | 605-360-8 | | Product Categories: | Amines;Aromatics;Heterocycles | | Mol File: | 16444-19-2.mol |  |
| | Norglipin Chemical Properties |
| storage temp. | 2-8°C | | solubility | Dichloromethane, DMSO, Methanol | | color | White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C21H23NO3/c23-20(25-19-13-17-11-12-18(14-19)22-17)21(24,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19,22,24H,11-14H2 | | InChIKey | HIIVXBCWDPCZJA-UHFFFAOYSA-N | | SMILES | N1C2CCC1CC(C2)OC(=O)C(O)(c4ccccc4)c3ccccc3 | | CAS DataBase Reference | 16444-19-2 |
| | Norglipin Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Intermediate for the preparation of Trospium Chloride. |
| | Norglipin Preparation Products And Raw materials |
|