|
|
| | 4,5-Dehydro-leucine Basic information |
| Product Name: | 4,5-Dehydro-leucine | | Synonyms: | H-LEU(4,5-DEHYDRO)-OH;H-4,5-DEHYDRO-LEU-OH;H-DLE(4,5)-OH;H-DELTALEU-OH;4,5-DEHYDRO-L-LEUCINE;4-entenoic acid, 2-amino-4-methyl-, (2S)-;4,5-Dehydro-L-leucine99+%;L-Methylallylglycine | | CAS: | 87392-13-0 | | MF: | C6H11NO2 | | MW: | 129.16 | | EINECS: | | | Product Categories: | | | Mol File: | 87392-13-0.mol |  |
| | 4,5-Dehydro-leucine Chemical Properties |
| Melting point | 202 °C (decomp) | | Boiling point | 234.305±33.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.066±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -15°C | | pka | 2.220±0.10(predicted) | | InChI | InChI=1S/C6H11NO2/c1-4(2)3-5(7)6(8)9/h5H,1,3,7H2,2H3,(H,8,9)/t5-/m0/s1 | | InChIKey | PABWDKROPVYJBH-YFKPBYRVSA-N | | SMILES | C(O)(=O)[C@@H](N)CC(C)=C |
| | 4,5-Dehydro-leucine Usage And Synthesis |
| | 4,5-Dehydro-leucine Preparation Products And Raw materials |
|