| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenylpropionate Basic information |
| Product Name: | Methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenylpropionate | | Synonyms: | METHYL (2R,3S)-2,3-DIHYDROXY-3-PHENYLPROPIONATE;methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenyl-propion;(2R,3S)-Methyl 2,3-dihydroxy-3-phenylpropanoate;methyl (2R,3S)-2,3-dihydroxy-3-phenylpropanoate;Benzenepropanoic acid, α,β-dihydroxy-, methyl ester, (αR,βS)-;Methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenylpropionate;Methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenylpropionate | | CAS: | 122743-18-4 | | MF: | C10H12O4 | | MW: | 196.2 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Esters;Organic Building Blocks | | Mol File: | 122743-18-4.mol |  |
| | Methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenylpropionate Chemical Properties |
| Melting point | 84-88 °C (lit.) | | Boiling point | 345.2±9.0 °C(Predicted) | | density | 1.266±0.06 g/cm3(Predicted) | | pka | 12.33±0.20(Predicted) | | Optical Rotation | [α]23/D +31°, c = 1 in H2O | | InChI | 1S/C10H12O4/c1-14-10(13)9(12)8(11)7-5-3-2-4-6-7/h2-6,8-9,11-12H,1H3/t8-,9+/m0/s1 | | InChIKey | IXDRYSIPXMREGK-DTWKUNHWSA-N | | SMILES | COC(=O)[C@H](O)[C@@H](O)c1ccccc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenylpropionate Usage And Synthesis |
| Uses | Methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenylpropionate can be used as an intermediate in the synthesis of:
- Biologically important 5-phenyl substituted Δ2-thiazolines.
- An antidepressant, (+)-(S)-dapoxetine.
- (R)-Cyclohexyl lactic acid, a building block required for the preparation of an E-selectin inhibitor.
|
| | Methyl (2R,3S)-(+)-2,3-dihydroxy-3-phenylpropionate Preparation Products And Raw materials |
|