| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (2-Hydroxyphenyl)(1-phenyl-1H-pyrazol-4-yl)methanone Basic information |
| | (2-Hydroxyphenyl)(1-phenyl-1H-pyrazol-4-yl)methanone Chemical Properties |
| Melting point | 108-110 °C(lit.) | | Boiling point | 421.9±20.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | pka | 7.52±0.30(Predicted) | | InChI | 1S/C16H12N2O2/c19-15-9-5-4-8-14(15)16(20)12-10-17-18(11-12)13-6-2-1-3-7-13/h1-11,19H | | InChIKey | WTRJNEICFURGNX-UHFFFAOYSA-N | | SMILES | Oc1ccccc1C(=O)c2cnn(c2)-c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (2-Hydroxyphenyl)(1-phenyl-1H-pyrazol-4-yl)methanone Usage And Synthesis |
| Uses | 2-Hydroxyphenyl 1-phenyl-1H-pyrazol-4-yl ketone is a heterocyclic building block. | | General Description | 2-Hydroxyphenyl 1-phenyl-1H-pyrazol-4-yl ketone is a heterocyclic building block. |
| | (2-Hydroxyphenyl)(1-phenyl-1H-pyrazol-4-yl)methanone Preparation Products And Raw materials |
|