RORIDIN A manufacturers
- Roridin A
-
-
2026-04-22
- CAS:14729-29-4
- Purity:
- Supply Ability: 10g
- Roridin A
-
-
2026-04-22
- CAS:14729-29-4
- Purity:
- Supply Ability: 10g
|
| | RORIDIN A Basic information |
| Product Name: | RORIDIN A | | Synonyms: | RORIDIN A;(7’r(r))-verrucarin;roridana;roridinea;roridin A from myrothecium sp cryst;Verrucarin A, 7'-deoxo-7'-(1-hydroxyethyl)-, [7'R(R)]-;roridin a from myrothecium sp.;Roridin A, Roridin C | | CAS: | 14729-29-4 | | MF: | C29H40O9 | | MW: | 532.62 | | EINECS: | 2387838 | | Product Categories: | | | Mol File: | 14729-29-4.mol |  |
| | RORIDIN A Chemical Properties |
| Melting point | 198-204 °C | | Boiling point | 752.4±60.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | chloroform: ≥10 mg/mL, clear, colorless | | form | powder | | pka | 12.83±0.70(Predicted) | | InChIKey | NSFWWJIQIKBZMJ-WZZABFCFNA-N | | SMILES | [C@@]12(OC1)C1O[C@@H]3C=C(C)CC[C@]43COC(=O)[C@@H](O)[C@H](C)CCOC(C(O)C)C=CC=CC(=O)O[C@H](C1)C24C |c:31,t:29,&1:0,5,11,16,18,34,r| | | CAS DataBase Reference | 14729-29-4 | | EPA Substance Registry System | Verrucarin A, 7'-deoxo-7'-[(1R)-1-hydroxyethyl]-, (7'R)- (14729-29-4) |
| Hazard Codes | T+ | | Risk Statements | 28 | | Safety Statements | 28-36/37-45 | | RIDADR | UN 3462 6.1/PG 1 | | WGK Germany | 3 | | RTECS | VL0355000 | | HazardClass | 6.1(a) | | PackingGroup | I |
| | RORIDIN A Usage And Synthesis |
| Uses | Roridin A is an inhibitor of pollen development in Arabidopsis thaliana. Roridin A is isolated from the fungus Cylindrocarpon sp. Roridin A inhibits the pollen development at concentrations of 2 μM[1]. | | References | [1] AtsumiShimada, et al. Roridin A and verrucarin A, inhibitors of pollen development in Arabidopsis thaliana, produced by Cylindrocarpon sp. |
| | RORIDIN A Preparation Products And Raw materials |
|