| Company Name: |
HitGen Inc. Gold |
| Tel: |
028-85197385 18628204893 |
| Email: |
jc.tang@hitgen.com |
|
| | Spacer-9 CEP Basic information |
| Product Name: | Spacer-9 CEP | | Synonyms: | 2-[2-[2-DMT]ethoxy]ethoxy]ethyl CE phosphoramidite;SPACER-9 Phosphoramidite;Phosphoramidous acid, N,N-bis(1-methylethyl)-, 2-[2-[2-[bis(4-methoxyphenyl)phenylmethoxy]ethoxy]ethoxy]ethyl 2-cyanoethyl ester;AMINOLINKER-18 PHOSPHORAMIDITE;TEG3-PHOSPHORAMIDITE;9-O-Dimethoxytrityl-triethylene glycol,1-[(2-cyanoethyl)-(N,N-diisopropyl)]-phosphoramidite;9-O-DMT-triethylene-glycol-1-(2-cyanoethyl)-(N,N-diisopropyl)-phosphoramidite;Spacer C9 CE Phosphoramidite | | CAS: | 146668-73-7 | | MF: | C36H49N2O7P | | MW: | 652.76 | | EINECS: | | | Product Categories: | Phosphoramidite | | Mol File: | 146668-73-7.mol |  |
| | Spacer-9 CEP Chemical Properties |
| Boiling point | 672.1±55.0 °C(Predicted) | | pka | 3.53±0.70(Predicted) | | InChIKey | PEJGGZVVBQPTRG-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(OCCOCCOCCOC(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)OCCC#N |
| | Spacer-9 CEP Usage And Synthesis |
| | Spacer-9 CEP Preparation Products And Raw materials |
|